C23H23ClN4O2S2 — CID 41189660
(3S)-1-(4-chlorobenzoyl)-3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one (PubChem CID 41189660) has the molecular formula C23H23ClN4O2S2 and a molecular weight of 487.05 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 41189660 |
| Molecular Formula | C23H23ClN4O2S2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-3-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]azepan-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC[C@H](Sc2nnc(Cc3cccs3)n2C2CC2)C1=O |
| InChI | InChI=1S/C23H23ClN4O2S2/c24-16-8-6-15(7-9-16)21(29)27-12-2-1-5-19(22(27)30)32-23-26-25-20(28(23)17-10-11-17)14-18-4-3-13-31-18/h3-4,6-9,13,17,19H,1-2,5,10-12,14H2/t19-/m0/s1 |
| InChIKey | SUTAYJRLCSCBCG-IBGZPJMESA-N |
| XLogP | 5.23 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|