C21H28N4OS2 — CID 8644947
1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 8644947) has the molecular formula C21H28N4OS2 and a molecular weight of 416.62 g/mol. Its IUPAC name is 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 8644947 |
| Molecular Formula | C21H28N4OS2 |
| Molecular Weight | 416.62 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(Cc2cccs2)n1C1CC1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C21H28N4OS2/c26-20(24-11-3-6-15-5-1-2-8-18(15)24)14-28-21-23-22-19(25(21)16-9-10-16)13-17-7-4-12-27-17/h4,7,12,15-16,18H,1-3,5-6,8-11,13-14H2/t15-,18-/m1/s1 |
| InChIKey | RKWPVUAAAYQGSV-CRAIPNDOSA-N |
| XLogP | 4.54 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |