C24H23ClN4O2S — CID 41170621
(3R)-1-(4-chlorobenzoyl)-3-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one (PubChem CID 41170621) has the molecular formula C24H23ClN4O2S and a molecular weight of 466.99 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 41170621 |
| Molecular Formula | C24H23ClN4O2S |
| Molecular Weight | 466.99 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-[(5-cyclopropyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC[C@@H](Sc2nnc(C3CC3)n2-c2ccccc2)C1=O |
| InChI | InChI=1S/C24H23ClN4O2S/c25-18-13-11-17(12-14-18)22(30)28-15-5-4-8-20(23(28)31)32-24-27-26-21(16-9-10-16)29(24)19-6-2-1-3-7-19/h1-3,6-7,11-14,16,20H,4-5,8-10,15H2/t20-/m1/s1 |
| InChIKey | IQERHURRQFCBKT-HXUWFJFHSA-N |
| XLogP | 5.11 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.99 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|