C24H25ClN4O2S — CID 16513847
3-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-chlorobenzoyl)azepan-2-one (PubChem CID 16513847) has the molecular formula C24H25ClN4O2S and a molecular weight of 469.01 g/mol. Its IUPAC name is 3-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-chlorobenzoyl)azepan-2-one.
| Compound Name | 3-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-chlorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 16513847 |
| Molecular Formula | C24H25ClN4O2S |
| Molecular Weight | 469.01 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 3-[(5-benzyl-4-ethyl-1,2,4-triazol-3-yl)sulfanyl]-1-(4-chlorobenzoyl)azepan-2-one |
| SMILES | CCn1c(Cc2ccccc2)nnc1SC1CCCCN(C(=O)c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H25ClN4O2S/c1-2-28-21(16-17-8-4-3-5-9-17)26-27-24(28)32-20-10-6-7-15-29(23(20)31)22(30)18-11-13-19(25)14-12-18/h3-5,8-9,11-14,20H,2,6-7,10,15-16H2,1H3 |
| InChIKey | UVBITCKIZZRVEZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.01 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|