C16H17ClN4O2S — CID 32892267
(3R)-1-(4-chlorobenzoyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one (PubChem CID 32892267) has the molecular formula C16H17ClN4O2S and a molecular weight of 364.86 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 32892267 |
| Molecular Formula | C16H17ClN4O2S |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
| SMILES | Cc1nc(S[C@@H]2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)n[nH]1 |
| InChI | InChI=1S/C16H17ClN4O2S/c1-10-18-16(20-19-10)24-13-4-2-3-9-21(15(13)23)14(22)11-5-7-12(17)8-6-11/h5-8,13H,2-4,9H2,1H3,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | CJAWRMOIUUSSAR-CYBMUJFWSA-N |
| XLogP | 3.08 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|