C19H17ClN4O2S2 — CID 24599748
3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one (PubChem CID 24599748) has the molecular formula C19H17ClN4O2S2 and a molecular weight of 432.96 g/mol. Its IUPAC name is 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one.
| Compound Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 24599748 |
| Molecular Formula | C19H17ClN4O2S2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one |
| SMILES | Nc1nc(SC2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)nc2sccc12 |
| InChI | InChI=1S/C19H17ClN4O2S2/c20-12-6-4-11(5-7-12)17(25)24-9-2-1-3-14(18(24)26)28-19-22-15(21)13-8-10-27-16(13)23-19/h4-8,10,14H,1-3,9H2,(H2,21,22,23) |
| InChIKey | SKBUXHOZZMRWPW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|