About 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one
3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one (PubChem CID 24599748) has the molecular formula C19H17ClN4O2S2
and a molecular weight of 432.96 g/mol. Its IUPAC name is 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one.
Molecular Properties
| Compound Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one |
| PubChem CID | 24599748 |
| Molecular Formula | C19H17ClN4O2S2 |
| Molecular Weight | 432.96 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one |
| SMILES | Nc1nc(SC2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)nc2sccc12 |
| InChI | InChI=1S/C19H17ClN4O2S2/c20-12-6-4-11(5-7-12)17(25)24-9-2-1-3-14(18(24)26)28-19-22-15(21)13-8-10-27-16(13)23-19/h4-8,10,14H,1-3,9H2,(H2,21,22,23) |
| InChIKey | SKBUXHOZZMRWPW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one?
The IUPAC name of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one (CID 24599748) is 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one.
What is the SMILES notation for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one?
The canonical SMILES for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one is Nc1nc(SC2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)nc2sccc12.
What is the InChIKey of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one?
The InChIKey is SKBUXHOZZMRWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN4O2S2/c20-12-6-4-11(5-7-12)17(25)24-9-2-1-3-14(18(24)26)28-19-22-15(21)13-8-10-27-16(13)23-19/h4-8,10,14H,1-3,9H2,(H2,21,22,23).
What are the key properties of 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one?
3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one has a molecular weight of 432.96 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-1-(4-chlorobenzoyl)azepan-2-one is sourced from PubChem (CID 24599748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).