C22H24ClN3O4S2 — CID 41471035
(3S)-1-(4-chlorobenzoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]azepan-2-one (PubChem CID 41471035) has the molecular formula C22H24ClN3O4S2 and a molecular weight of 494.04 g/mol. Its IUPAC name is (3S)-1-(4-chlorobenzoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]azepan-2-one.
| Compound Name | (3S)-1-(4-chlorobenzoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 41471035 |
| Molecular Formula | C22H24ClN3O4S2 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | (3S)-1-(4-chlorobenzoyl)-3-[(5-pyrrolidin-1-ylsulfonyl-2-pyridinyl)sulfanyl]azepan-2-one |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCCC[C@H](Sc2ccc(S(=O)(=O)N3CCCC3)cn2)C1=O |
| InChI | InChI=1S/C22H24ClN3O4S2/c23-17-8-6-16(7-9-17)21(27)26-14-2-1-5-19(22(26)28)31-20-11-10-18(15-24-20)32(29,30)25-12-3-4-13-25/h6-11,15,19H,1-5,12-14H2/t19-/m0/s1 |
| InChIKey | ASDNYZKOCAGKTO-IBGZPJMESA-N |
| XLogP | 3.83 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|