C18H21ClN4O2S2 — CID 40818789
(3R)-1-(4-chlorobenzoyl)-3-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]azepan-2-one (PubChem CID 40818789) has the molecular formula C18H21ClN4O2S2 and a molecular weight of 424.98 g/mol. Its IUPAC name is (3R)-1-(4-chlorobenzoyl)-3-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]azepan-2-one.
| Compound Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]azepan-2-one |
|---|---|
| PubChem CID | 40818789 |
| Molecular Formula | C18H21ClN4O2S2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | (3R)-1-(4-chlorobenzoyl)-3-[[5-(propan-2-ylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]azepan-2-one |
| SMILES | CC(C)Nc1nnc(S[C@@H]2CCCCN(C(=O)c3ccc(Cl)cc3)C2=O)s1 |
| InChI | InChI=1S/C18H21ClN4O2S2/c1-11(2)20-17-21-22-18(27-17)26-14-5-3-4-10-23(16(14)25)15(24)12-6-8-13(19)9-7-12/h6-9,11,14H,3-5,10H2,1-2H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | FPZSXGWGKISBMZ-CQSZACIVSA-N |
| XLogP | 4.33 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|