C20H19N5O2S — CID 2312396
(3S)-1-benzoyl-3-(1-phenyltetrazol-5-yl)sulfanylazepan-2-one (PubChem CID 2312396) has the molecular formula C20H19N5O2S and a molecular weight of 393.47 g/mol. Its IUPAC name is (3S)-1-benzoyl-3-(1-phenyltetrazol-5-yl)sulfanylazepan-2-one.
| Compound Name | (3S)-1-benzoyl-3-(1-phenyltetrazol-5-yl)sulfanylazepan-2-one |
|---|---|
| PubChem CID | 2312396 |
| Molecular Formula | C20H19N5O2S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (3S)-1-benzoyl-3-(1-phenyltetrazol-5-yl)sulfanylazepan-2-one |
| SMILES | O=C(c1ccccc1)N1CCCC[C@H](Sc2nnnn2-c2ccccc2)C1=O |
| InChI | InChI=1S/C20H19N5O2S/c26-18(15-9-3-1-4-10-15)24-14-8-7-13-17(19(24)27)28-20-21-22-23-25(20)16-11-5-2-6-12-16/h1-6,9-12,17H,7-8,13-14H2/t17-/m0/s1 |
| InChIKey | DZSLJHGJQVCXSK-KRWDZBQOSA-N |
| XLogP | 2.98 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|