C13H15N5OS — CID 22964966
S-(1-phenyltetrazol-5-yl) piperidine-1-carbothioate (PubChem CID 22964966) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is S-(1-phenyltetrazol-5-yl) piperidine-1-carbothioate.
| Compound Name | S-(1-phenyltetrazol-5-yl) piperidine-1-carbothioate |
|---|---|
| PubChem CID | 22964966 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | S-(1-phenyltetrazol-5-yl) piperidine-1-carbothioate |
| SMILES | O=C(Sc1nnnn1-c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C13H15N5OS/c19-13(17-9-5-2-6-10-17)20-12-14-15-16-18(12)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2 |
| InChIKey | XLBTYTBZHBZDKC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|