C9H8N4O4S2 — CID 159162962
carbonic acid;(1-phenyltetrazol-5-yl)sulfanylmethanethioic S-acid (PubChem CID 159162962) has the molecular formula C9H8N4O4S2 and a molecular weight of 300.32 g/mol. Its IUPAC name is carbonic acid;(1-phenyltetrazol-5-yl)sulfanylmethanethioic S-acid.
| Compound Name | carbonic acid;(1-phenyltetrazol-5-yl)sulfanylmethanethioic S-acid |
|---|---|
| PubChem CID | 159162962 |
| Molecular Formula | C9H8N4O4S2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | carbonic acid;(1-phenyltetrazol-5-yl)sulfanylmethanethioic S-acid |
| SMILES | O=C(O)O.O=C(S)Sc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C8H6N4OS2.CH2O3/c13-8(14)15-7-9-10-11-12(7)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H,13,14);(H2,2,3,4) |
| InChIKey | KKSOANQKNMCCRD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|