C16H12ClN5O2S — CID 2363223
S-(1-phenyltetrazol-5-yl) 3-(4-chloroanilino)-3-oxopropanethioate (PubChem CID 2363223) has the molecular formula C16H12ClN5O2S and a molecular weight of 373.83 g/mol. Its IUPAC name is S-(1-phenyltetrazol-5-yl) 3-(4-chloroanilino)-3-oxopropanethioate.
| Compound Name | S-(1-phenyltetrazol-5-yl) 3-(4-chloroanilino)-3-oxopropanethioate |
|---|---|
| PubChem CID | 2363223 |
| Molecular Formula | C16H12ClN5O2S |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | S-(1-phenyltetrazol-5-yl) 3-(4-chloroanilino)-3-oxopropanethioate |
| SMILES | O=C(CC(=O)Sc1nnnn1-c1ccccc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClN5O2S/c17-11-6-8-12(9-7-11)18-14(23)10-15(24)25-16-19-20-21-22(16)13-4-2-1-3-5-13/h1-9H,10H2,(H,18,23) |
| InChIKey | AEKLIAMBFJWVSR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|