C19H18ClN5O2S — CID 7560622
N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]phenyl]butanamide (PubChem CID 7560622) has the molecular formula C19H18ClN5O2S and a molecular weight of 415.91 g/mol. Its IUPAC name is N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]phenyl]butanamide.
| Compound Name | N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]phenyl]butanamide |
|---|---|
| PubChem CID | 7560622 |
| Molecular Formula | C19H18ClN5O2S |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[4-[2-[1-(4-chlorophenyl)tetrazol-5-yl]sulfanylacetyl]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)CSc2nnnn2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H18ClN5O2S/c1-2-3-18(27)21-15-8-4-13(5-9-15)17(26)12-28-19-22-23-24-25(19)16-10-6-14(20)7-11-16/h4-11H,2-3,12H2,1H3,(H,21,27) |
| InChIKey | KPNMHICBYGMSFY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |