C22H22FN5O2S — CID 16578571
3-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one (PubChem CID 16578571) has the molecular formula C22H22FN5O2S and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one.
| Compound Name | 3-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
|---|---|
| PubChem CID | 16578571 |
| Molecular Formula | C22H22FN5O2S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 3-[[4-amino-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-1-(4-fluorobenzoyl)azepan-2-one |
| SMILES | Cc1ccc(-c2nnc(SC3CCCCN(C(=O)c4ccc(F)cc4)C3=O)n2N)cc1 |
| InChI | InChI=1S/C22H22FN5O2S/c1-14-5-7-15(8-6-14)19-25-26-22(28(19)24)31-18-4-2-3-13-27(21(18)30)20(29)16-9-11-17(23)12-10-16/h5-12,18H,2-4,13,24H2,1H3 |
| InChIKey | RIIBEXBZCUZGKQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|