C23H25F2N3O4S — CID 24981880
[1-(4-fluorobenzoyl)piperidin-4-yl]-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 24981880) has the molecular formula C23H25F2N3O4S and a molecular weight of 477.53 g/mol. Its IUPAC name is [1-(4-fluorobenzoyl)piperidin-4-yl]-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | [1-(4-fluorobenzoyl)piperidin-4-yl]-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 24981880 |
| Molecular Formula | C23H25F2N3O4S |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | [1-(4-fluorobenzoyl)piperidin-4-yl]-[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCC(C(=O)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C23H25F2N3O4S/c24-19-6-4-17(5-7-19)22(29)26-10-8-18(9-11-26)23(30)27-12-14-28(15-13-27)33(31,32)21-3-1-2-20(25)16-21/h1-7,16,18H,8-15H2 |
| InChIKey | LKBIDYMPSIGELE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |