C23H28FN3O3S — CID 19291254
[1-(benzenesulfonyl)piperidin-4-yl]-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19291254) has the molecular formula C23H28FN3O3S and a molecular weight of 445.56 g/mol. Its IUPAC name is [1-(benzenesulfonyl)piperidin-4-yl]-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)piperidin-4-yl]-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19291254 |
| Molecular Formula | C23H28FN3O3S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | [1-(benzenesulfonyl)piperidin-4-yl]-[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1CCN(S(=O)(=O)c2ccccc2)CC1)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H28FN3O3S/c24-21-6-4-5-19(17-21)18-25-13-15-26(16-14-25)23(28)20-9-11-27(12-10-20)31(29,30)22-7-2-1-3-8-22/h1-8,17,20H,9-16,18H2 |
| InChIKey | VABLVAPYUUNJAX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |