C22H24FN3O4S — CID 42997236
1-benzyl-4-[4-(3-fluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 42997236) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-benzyl-4-[4-(3-fluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-benzyl-4-[4-(3-fluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42997236 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-benzyl-4-[4-(3-fluorophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CC(C(=O)N2CCN(S(=O)(=O)c3cccc(F)c3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H24FN3O4S/c23-19-7-4-8-20(14-19)31(29,30)26-11-9-24(10-12-26)22(28)18-13-21(27)25(16-18)15-17-5-2-1-3-6-17/h1-8,14,18H,9-13,15-16H2 |
| InChIKey | KAWBDNXDCLNTNN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |