C11H10O7S — CID 90246272
3-(2-oxooxolan-3-yl)oxycarbonylbenzenesulfonic acid (PubChem CID 90246272) has the molecular formula C11H10O7S and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-(2-oxooxolan-3-yl)oxycarbonylbenzenesulfonic acid.
| Compound Name | 3-(2-oxooxolan-3-yl)oxycarbonylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90246272 |
| Molecular Formula | C11H10O7S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-(2-oxooxolan-3-yl)oxycarbonylbenzenesulfonic acid |
| SMILES | O=C(OC1CCOC1=O)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C11H10O7S/c12-10(18-9-4-5-17-11(9)13)7-2-1-3-8(6-7)19(14,15)16/h1-3,6,9H,4-5H2,(H,14,15,16) |
| InChIKey | MIZXNYFROUUECZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|