C18H21NO7S — CID 7891737
[(3S)-2-oxooxolan-3-yl] 1-(3-acetylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 7891737) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 1-(3-acetylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 1-(3-acetylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 7891737 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 1-(3-acetylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)O[C@H]3CCOC3=O)CC2)c1 |
| InChI | InChI=1S/C18H21NO7S/c1-12(20)14-3-2-4-15(11-14)27(23,24)19-8-5-13(6-9-19)17(21)26-16-7-10-25-18(16)22/h2-4,11,13,16H,5-10H2,1H3/t16-/m0/s1 |
| InChIKey | DYXLDGBZOKSYPI-INIZCTEOSA-N |
| XLogP | 1.15 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |