C15H17NO6S — CID 2509169
[(3R)-2-oxooxolan-3-yl] 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2509169) has the molecular formula C15H17NO6S and a molecular weight of 339.37 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2509169 |
| Molecular Formula | C15H17NO6S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C15H17NO6S/c17-14(22-13-6-9-21-15(13)18)11-4-3-5-12(10-11)23(19,20)16-7-1-2-8-16/h3-5,10,13H,1-2,6-9H2/t13-/m1/s1 |
| InChIKey | WZYDGXFHTHTWSZ-CYBMUJFWSA-N |
| XLogP | 0.94 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |