C21H29NO5S — CID 11927980
[(2S,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 11927980) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is [(2S,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(2S,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 11927980 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | [(2S,4aR,8aR)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(O[C@H]1CC[C@H]2CCCC[C@@H]2C1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C21H29NO5S/c23-21(27-19-9-8-16-4-1-2-5-17(16)14-19)18-6-3-7-20(15-18)28(24,25)22-10-12-26-13-11-22/h3,6-7,15-17,19H,1-2,4-5,8-14H2/t16-,17-,19+/m1/s1 |
| InChIKey | VBLZGFCJGUNZFL-LMMKCTJWSA-N |
| XLogP | 3.22 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |