C16H18FNO6S — CID 24687203
(2-oxooxolan-3-yl) 4-fluoro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 24687203) has the molecular formula C16H18FNO6S and a molecular weight of 371.39 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 4-fluoro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (2-oxooxolan-3-yl) 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 24687203 |
| Molecular Formula | C16H18FNO6S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (2-oxooxolan-3-yl) 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OC1CCOC1=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C16H18FNO6S/c17-12-5-4-11(15(19)24-13-6-9-23-16(13)20)10-14(12)25(21,22)18-7-2-1-3-8-18/h4-5,10,13H,1-3,6-9H2 |
| InChIKey | GJKPIRFMDJDQLW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |