C18H24FNO6S — CID 27010595
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 27010595) has the molecular formula C18H24FNO6S and a molecular weight of 401.46 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 27010595 |
| Molecular Formula | C18H24FNO6S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] 4-fluoro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC(C)(C)OC(=O)COC(=O)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C18H24FNO6S/c1-18(2,3)26-16(21)12-25-17(22)13-7-8-14(19)15(11-13)27(23,24)20-9-5-4-6-10-20/h7-8,11H,4-6,9-10,12H2,1-3H3 |
| InChIKey | SBBULXZDPKASDP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |