C16H19NO6S — CID 55378752
(5-methyl-2-oxooxolan-3-yl) 3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 55378752) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is (5-methyl-2-oxooxolan-3-yl) 3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (5-methyl-2-oxooxolan-3-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55378752 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (5-methyl-2-oxooxolan-3-yl) 3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | CC1CC(OC(=O)c2cccc(S(=O)(=O)N3CCCC3)c2)C(=O)O1 |
| InChI | InChI=1S/C16H19NO6S/c1-11-9-14(16(19)22-11)23-15(18)12-5-4-6-13(10-12)24(20,21)17-7-2-3-8-17/h4-6,10-11,14H,2-3,7-9H2,1H3 |
| InChIKey | UXMZLTUBPIXHJF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |