C12H13NO6S — CID 47066852
methyl 3-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]benzoate (PubChem CID 47066852) has the molecular formula C12H13NO6S and a molecular weight of 299.30 g/mol. Its IUPAC name is methyl 3-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]benzoate.
| Compound Name | methyl 3-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 47066852 |
| Molecular Formula | C12H13NO6S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | methyl 3-[[(3S)-2-oxooxolan-3-yl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N[C@H]2CCOC2=O)c1 |
| InChI | InChI=1S/C12H13NO6S/c1-18-11(14)8-3-2-4-9(7-8)20(16,17)13-10-5-6-19-12(10)15/h2-4,7,10,13H,5-6H2,1H3/t10-/m0/s1 |
| InChIKey | PTHOVFPJIHZSRV-JTQLQIEISA-N |
| XLogP | 0.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |