C11H12N2O4S2 — CID 43822814
3-[(2-oxooxolan-3-yl)sulfamoyl]benzenecarbothioamide (PubChem CID 43822814) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[(2-oxooxolan-3-yl)sulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(2-oxooxolan-3-yl)sulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 43822814 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3-[(2-oxooxolan-3-yl)sulfamoyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(S(=O)(=O)NC2CCOC2=O)c1 |
| InChI | InChI=1S/C11H12N2O4S2/c12-10(18)7-2-1-3-8(6-7)19(15,16)13-9-4-5-17-11(9)14/h1-3,6,9,13H,4-5H2,(H2,12,18) |
| InChIKey | DWUGIESYWKDKKX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|