C18H16N2O3S2 — CID 75402424
[4-(1,3-dithiolan-2-yl)phenyl] 3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 75402424) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 75402424 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 3,6-dimethyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2ccc(C3SCCS3)cc2)c2c(C)noc2n1 |
| InChI | InChI=1S/C18H16N2O3S2/c1-10-9-14(15-11(2)20-23-16(15)19-10)17(21)22-13-5-3-12(4-6-13)18-24-7-8-25-18/h3-6,9,18H,7-8H2,1-2H3 |
| InChIKey | HGRDORMDZXQVOZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|