C21H18N2O5 — CID 18145006
(4-methoxyphenyl) 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate (PubChem CID 18145006) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is (4-methoxyphenyl) 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate.
| Compound Name | (4-methoxyphenyl) 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 18145006 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | (4-methoxyphenyl) 6-(2,5-dimethylfuran-3-yl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxylate |
| SMILES | COc1ccc(OC(=O)c2cc(-c3cc(C)oc3C)nc3onc(C)c23)cc1 |
| InChI | InChI=1S/C21H18N2O5/c1-11-9-16(13(3)26-11)18-10-17(19-12(2)23-28-20(19)22-18)21(24)27-15-7-5-14(25-4)6-8-15/h5-10H,1-4H3 |
| InChIKey | DLZXEOHPBNSYPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|