C15H15NO3S2 — CID 33084402
(3-methyl-1,2-oxazol-5-yl)methyl 4-(1,3-dithiolan-2-yl)benzoate (PubChem CID 33084402) has the molecular formula C15H15NO3S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 4-(1,3-dithiolan-2-yl)benzoate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
|---|---|
| PubChem CID | 33084402 |
| Molecular Formula | C15H15NO3S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 4-(1,3-dithiolan-2-yl)benzoate |
| SMILES | Cc1cc(COC(=O)c2ccc(C3SCCS3)cc2)on1 |
| InChI | InChI=1S/C15H15NO3S2/c1-10-8-13(19-16-10)9-18-14(17)11-2-4-12(5-3-11)15-20-6-7-21-15/h2-5,8,15H,6-7,9H2,1H3 |
| InChIKey | HQRDSHHSUCLNIX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |