C24H20O4S2 — CID 18228432
[4-(1,3-dithiolan-2-yl)phenyl] 2-(4-benzoylphenoxy)acetate (PubChem CID 18228432) has the molecular formula C24H20O4S2 and a molecular weight of 436.55 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] 2-(4-benzoylphenoxy)acetate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] 2-(4-benzoylphenoxy)acetate |
|---|---|
| PubChem CID | 18228432 |
| Molecular Formula | C24H20O4S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] 2-(4-benzoylphenoxy)acetate |
| SMILES | O=C(COc1ccc(C(=O)c2ccccc2)cc1)Oc1ccc(C2SCCS2)cc1 |
| InChI | InChI=1S/C24H20O4S2/c25-22(28-21-12-8-19(9-13-21)24-29-14-15-30-24)16-27-20-10-6-18(7-11-20)23(26)17-4-2-1-3-5-17/h1-13,24H,14-16H2 |
| InChIKey | FZLORMDTJTWJNZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|