C20H19NO3S2 — CID 9110820
(2-cyanophenyl)methyl 2-[4-(1,3-dithian-2-yl)phenoxy]acetate (PubChem CID 9110820) has the molecular formula C20H19NO3S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2-cyanophenyl)methyl 2-[4-(1,3-dithian-2-yl)phenoxy]acetate.
| Compound Name | (2-cyanophenyl)methyl 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 9110820 |
| Molecular Formula | C20H19NO3S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | (2-cyanophenyl)methyl 2-[4-(1,3-dithian-2-yl)phenoxy]acetate |
| SMILES | N#Cc1ccccc1COC(=O)COc1ccc(C2SCCCS2)cc1 |
| InChI | InChI=1S/C20H19NO3S2/c21-12-16-4-1-2-5-17(16)13-24-19(22)14-23-18-8-6-15(7-9-18)20-25-10-3-11-26-20/h1-2,4-9,20H,3,10-11,13-14H2 |
| InChIKey | QWHKMHZYTMCXLF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |