C18H22N2O2S2 — CID 86913662
N-(1-cyanocyclopentyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide (PubChem CID 86913662) has the molecular formula C18H22N2O2S2 and a molecular weight of 362.52 g/mol. Its IUPAC name is N-(1-cyanocyclopentyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide.
| Compound Name | N-(1-cyanocyclopentyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 86913662 |
| Molecular Formula | C18H22N2O2S2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-(1-cyanocyclopentyl)-2-[4-(1,3-dithian-2-yl)phenoxy]acetamide |
| SMILES | N#CC1(NC(=O)COc2ccc(C3SCCCS3)cc2)CCCC1 |
| InChI | InChI=1S/C18H22N2O2S2/c19-13-18(8-1-2-9-18)20-16(21)12-22-15-6-4-14(5-7-15)17-23-10-3-11-24-17/h4-7,17H,1-3,8-12H2,(H,20,21) |
| InChIKey | OLUWVJNWWSYXMU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |