C16H20N2O4S — CID 51174585
N-(1-cyanocyclohexyl)-2-(4-methylsulfonylphenoxy)acetamide (PubChem CID 51174585) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-(4-methylsulfonylphenoxy)acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-(4-methylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 51174585 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-(4-methylsulfonylphenoxy)acetamide |
| SMILES | CS(=O)(=O)c1ccc(OCC(=O)NC2(C#N)CCCCC2)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-23(20,21)14-7-5-13(6-8-14)22-11-15(19)18-16(12-17)9-3-2-4-10-16/h5-8H,2-4,9-11H2,1H3,(H,18,19) |
| InChIKey | MGERPVRZKOGCIN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |