C16H20O2S2 — CID 670641
[4-(1,3-dithiolan-2-yl)phenyl] cyclohexanecarboxylate (PubChem CID 670641) has the molecular formula C16H20O2S2 and a molecular weight of 308.47 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)phenyl] cyclohexanecarboxylate.
| Compound Name | [4-(1,3-dithiolan-2-yl)phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 670641 |
| Molecular Formula | C16H20O2S2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)phenyl] cyclohexanecarboxylate |
| SMILES | O=C(Oc1ccc(C2SCCS2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C16H20O2S2/c17-15(12-4-2-1-3-5-12)18-14-8-6-13(7-9-14)16-19-10-11-20-16/h6-9,12,16H,1-5,10-11H2 |
| InChIKey | PWZWILAULIEQKG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|