About thiophen-3-yl cyclopentanecarboxylate
thiophen-3-yl cyclopentanecarboxylate (PubChem CID 70344436) has the molecular formula C10H12O2S
and a molecular weight of 196.27 g/mol. Its IUPAC name is thiophen-3-yl cyclopentanecarboxylate.
Molecular Properties
| Compound Name | thiophen-3-yl cyclopentanecarboxylate |
| PubChem CID | 70344436 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | thiophen-3-yl cyclopentanecarboxylate |
| SMILES | O=C(Oc1ccsc1)C1CCCC1 |
| InChI | InChI=1S/C10H12O2S/c11-10(8-3-1-2-4-8)12-9-5-6-13-7-9/h5-8H,1-4H2 |
| InChIKey | AWPYILBQRQKFTQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiophen-3-yl cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-3-yl cyclopentanecarboxylate?
The IUPAC name of thiophen-3-yl cyclopentanecarboxylate (CID 70344436) is thiophen-3-yl cyclopentanecarboxylate.
What is the SMILES notation for thiophen-3-yl cyclopentanecarboxylate?
The canonical SMILES for thiophen-3-yl cyclopentanecarboxylate is O=C(Oc1ccsc1)C1CCCC1.
What is the InChIKey of thiophen-3-yl cyclopentanecarboxylate?
The InChIKey is AWPYILBQRQKFTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c11-10(8-3-1-2-4-8)12-9-5-6-13-7-9/h5-8H,1-4H2.
What are the key properties of thiophen-3-yl cyclopentanecarboxylate?
thiophen-3-yl cyclopentanecarboxylate has a molecular weight of 196.27 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-3-yl cyclopentanecarboxylate is sourced from PubChem (CID 70344436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).