C17H15NO5S2 — CID 7992826
[4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-nitrobenzoate (PubChem CID 7992826) has the molecular formula C17H15NO5S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-nitrobenzoate.
| Compound Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7992826 |
| Molecular Formula | C17H15NO5S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [4-(1,3-dithiolan-2-yl)-2-methoxyphenyl] 4-nitrobenzoate |
| SMILES | COc1cc(C2SCCS2)ccc1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NO5S2/c1-22-15-10-12(17-24-8-9-25-17)4-7-14(15)23-16(19)11-2-5-13(6-3-11)18(20)21/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | OUFWORSHGQNULN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|