C19H20O4S2 — CID 7706301
methyl 4-[[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]methyl]benzoate (PubChem CID 7706301) has the molecular formula C19H20O4S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is methyl 4-[[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7706301 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | methyl 4-[[4-(1,3-dithiolan-2-yl)-2-methoxyphenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(C3SCCS3)cc2OC)cc1 |
| InChI | InChI=1S/C19H20O4S2/c1-21-17-11-15(19-24-9-10-25-19)7-8-16(17)23-12-13-3-5-14(6-4-13)18(20)22-2/h3-8,11,19H,9-10,12H2,1-2H3 |
| InChIKey | JIGUXZLNPSZZIJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |