C26H35N3O8 — CID 142608995
tert-butyl N-hexylcarbamate;(4-formamidophenyl)methyl (4-nitrophenyl) carbonate (PubChem CID 142608995) has the molecular formula C26H35N3O8 and a molecular weight of 517.58 g/mol. Its IUPAC name is tert-butyl N-hexylcarbamate;(4-formamidophenyl)methyl (4-nitrophenyl) carbonate.
| Compound Name | tert-butyl N-hexylcarbamate;(4-formamidophenyl)methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 142608995 |
| Molecular Formula | C26H35N3O8 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | tert-butyl N-hexylcarbamate;(4-formamidophenyl)methyl (4-nitrophenyl) carbonate |
| SMILES | CCCCCCNC(=O)OC(C)(C)C.O=CNc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H12N2O6.C11H23NO2/c18-10-16-12-3-1-11(2-4-12)9-22-15(19)23-14-7-5-13(6-8-14)17(20)21;1-5-6-7-8-9-12-10(13)14-11(2,3)4/h1-8,10H,9H2,(H,16,18);5-9H2,1-4H3,(H,12,13) |
| InChIKey | MLOYGFIFXTXSEY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|