C28H35N5O9 — CID 156509792
[4-[[2-[[2-(6-formamidohexanoylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate (PubChem CID 156509792) has the molecular formula C28H35N5O9 and a molecular weight of 585.61 g/mol. Its IUPAC name is [4-[[2-[[2-(6-formamidohexanoylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate.
| Compound Name | [4-[[2-[[2-(6-formamidohexanoylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 156509792 |
| Molecular Formula | C28H35N5O9 |
| Molecular Weight | 585.61 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | [4-[[2-[[2-(6-formamidohexanoylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| SMILES | CC(C)C(NC(=O)CCCCCNC=O)C(=O)NCC(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H35N5O9/c1-19(2)26(32-24(35)6-4-3-5-15-29-18-34)27(37)30-16-25(36)31-21-9-7-20(8-10-21)17-41-28(38)42-23-13-11-22(12-14-23)33(39)40/h7-14,18-19,26H,3-6,15-17H2,1-2H3,(H,29,34)(H,30,37)(H,31,36)(H,32,35) |
| InChIKey | PXRFLDOAILGTGU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 195.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|