C17H25ClN4O2Si — CID 158798521
6-chloro-4-[(3-cyclopropyl-2H-pyrrol-5-yl)amino]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one (PubChem CID 158798521) has the molecular formula C17H25ClN4O2Si and a molecular weight of 380.95 g/mol. Its IUPAC name is 6-chloro-4-[(3-cyclopropyl-2H-pyrrol-5-yl)amino]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one.
| Compound Name | 6-chloro-4-[(3-cyclopropyl-2H-pyrrol-5-yl)amino]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 158798521 |
| Molecular Formula | C17H25ClN4O2Si |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 6-chloro-4-[(3-cyclopropyl-2H-pyrrol-5-yl)amino]-2-(2-trimethylsilylethoxymethyl)pyridazin-3-one |
| SMILES | C[Si](C)(C)CCOCn1nc(Cl)cc(NC2=NCC(C3CC3)=C2)c1=O |
| InChI | InChI=1S/C17H25ClN4O2Si/c1-25(2,3)7-6-24-11-22-17(23)14(9-15(18)21-22)20-16-8-13(10-19-16)12-4-5-12/h8-9,12H,4-7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | ITECREOZFGUPTH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|