C17H23ClF3N3O2Si — CID 154698271
6-chloro-N-(oxetan-3-yl)-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine (PubChem CID 154698271) has the molecular formula C17H23ClF3N3O2Si and a molecular weight of 421.92 g/mol. Its IUPAC name is 6-chloro-N-(oxetan-3-yl)-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine.
| Compound Name | 6-chloro-N-(oxetan-3-yl)-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 154698271 |
| Molecular Formula | C17H23ClF3N3O2Si |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 6-chloro-N-(oxetan-3-yl)-3-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-amine |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c2c(NC3COC3)cc(Cl)nc21 |
| InChI | InChI=1S/C17H23ClF3N3O2Si/c1-27(2,3)5-4-25-10-24-7-12(17(19,20)21)15-13(22-11-8-26-9-11)6-14(18)23-16(15)24/h6-7,11H,4-5,8-10H2,1-3H3,(H,22,23) |
| InChIKey | HMAPZSZEDKUBPY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|