C17H25ClN4O2Si — CID 169206580
5-chloro-7-ethenyl-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-3-amine (PubChem CID 169206580) has the molecular formula C17H25ClN4O2Si and a molecular weight of 380.95 g/mol. Its IUPAC name is 5-chloro-7-ethenyl-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-3-amine.
| Compound Name | 5-chloro-7-ethenyl-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-3-amine |
|---|---|
| PubChem CID | 169206580 |
| Molecular Formula | C17H25ClN4O2Si |
| Molecular Weight | 380.95 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 5-chloro-7-ethenyl-N-(oxetan-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-b]pyridin-3-amine |
| SMILES | C=Cc1cc(Cl)nc2c(NC3COC3)nn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C17H25ClN4O2Si/c1-5-12-8-14(18)20-15-16(12)22(11-23-6-7-25(2,3)4)21-17(15)19-13-9-24-10-13/h5,8,13H,1,6-7,9-11H2,2-4H3,(H,19,21) |
| InChIKey | BBJLLYGVXJTSKF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.95 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|