C17H24BrIN2O2Si — CID 153306690
2-[[5-bromo-3-iodo-7-(prop-2-enoxymethyl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 153306690) has the molecular formula C17H24BrIN2O2Si and a molecular weight of 523.29 g/mol. Its IUPAC name is 2-[[5-bromo-3-iodo-7-(prop-2-enoxymethyl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-bromo-3-iodo-7-(prop-2-enoxymethyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 153306690 |
| Molecular Formula | C17H24BrIN2O2Si |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | 2-[[5-bromo-3-iodo-7-(prop-2-enoxymethyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C=CCOCc1cc(Br)cc2c(I)nn(COCC[Si](C)(C)C)c12 |
| InChI | InChI=1S/C17H24BrIN2O2Si/c1-5-6-22-11-13-9-14(18)10-15-16(13)21(20-17(15)19)12-23-7-8-24(2,3)4/h5,9-10H,1,6-8,11-12H2,2-4H3 |
| InChIKey | WJHLSBKROOJBAW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|