C11H18IN5OSi — CID 162518295
3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 162518295) has the molecular formula C11H18IN5OSi and a molecular weight of 391.29 g/mol. Its IUPAC name is 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 162518295 |
| Molecular Formula | C11H18IN5OSi |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 3-iodo-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | C[Si](C)(C)CCOCn1nc(I)c2ncnc(N)c21 |
| InChI | InChI=1S/C11H18IN5OSi/c1-19(2,3)5-4-18-7-17-9-8(10(12)16-17)14-6-15-11(9)13/h6H,4-5,7H2,1-3H3,(H2,13,14,15) |
| InChIKey | HHGYASORQOUPLK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|