C12H21BN4O3Si — CID 162489265
[4-amino-5-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidin-7-yl]boronic acid (PubChem CID 162489265) has the molecular formula C12H21BN4O3Si and a molecular weight of 308.22 g/mol. Its IUPAC name is [4-amino-5-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidin-7-yl]boronic acid.
| Compound Name | [4-amino-5-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidin-7-yl]boronic acid |
|---|---|
| PubChem CID | 162489265 |
| Molecular Formula | C12H21BN4O3Si |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [4-amino-5-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-d]pyrimidin-7-yl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(B(O)O)c2ncnc(N)c21 |
| InChI | InChI=1S/C12H21BN4O3Si/c1-21(2,3)5-4-20-8-17-6-9(13(18)19)10-11(17)12(14)16-7-15-10/h6-7,18-19H,4-5,8H2,1-3H3,(H2,14,15,16) |
| InChIKey | GESGCRCOWHRFHW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|