C29H37F2N5O3SSi — CID 66773372
5-(2,6-difluorophenyl)-N-(1-ethylsulfonylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinolin-3-amine (PubChem CID 66773372) has the molecular formula C29H37F2N5O3SSi and a molecular weight of 601.80 g/mol. Its IUPAC name is 5-(2,6-difluorophenyl)-N-(1-ethylsulfonylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinolin-3-amine.
| Compound Name | 5-(2,6-difluorophenyl)-N-(1-ethylsulfonylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinolin-3-amine |
|---|---|
| PubChem CID | 66773372 |
| Molecular Formula | C29H37F2N5O3SSi |
| Molecular Weight | 601.80 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 5-(2,6-difluorophenyl)-N-(1-ethylsulfonylpiperidin-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,5-c]isoquinolin-3-amine |
| SMILES | CCS(=O)(=O)N1CCC(Nc2nn(COCC[Si](C)(C)C)c3c2nc(-c2c(F)cccc2F)c2ccccc23)CC1 |
| InChI | InChI=1S/C29H37F2N5O3SSi/c1-5-40(37,38)35-15-13-20(14-16-35)32-29-27-28(36(34-29)19-39-17-18-41(2,3)4)22-10-7-6-9-21(22)26(33-27)25-23(30)11-8-12-24(25)31/h6-12,20H,5,13-19H2,1-4H3,(H,32,34) |
| InChIKey | NOOUKMFDRPQQGT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.80 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|