C18H27ClN2O3Si — CID 140806183
2-chloro-8,8-dimethyl-6-(2-trimethylsilylethoxymethyl)spiro[1,6-naphthyridine-5,3'-oxetane]-7-one (PubChem CID 140806183) has the molecular formula C18H27ClN2O3Si and a molecular weight of 382.96 g/mol. Its IUPAC name is 2-chloro-8,8-dimethyl-6-(2-trimethylsilylethoxymethyl)spiro[1,6-naphthyridine-5,3'-oxetane]-7-one.
| Compound Name | 2-chloro-8,8-dimethyl-6-(2-trimethylsilylethoxymethyl)spiro[1,6-naphthyridine-5,3'-oxetane]-7-one |
|---|---|
| PubChem CID | 140806183 |
| Molecular Formula | C18H27ClN2O3Si |
| Molecular Weight | 382.96 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-chloro-8,8-dimethyl-6-(2-trimethylsilylethoxymethyl)spiro[1,6-naphthyridine-5,3'-oxetane]-7-one |
| SMILES | CC1(C)C(=O)N(COCC[Si](C)(C)C)C2(COC2)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C18H27ClN2O3Si/c1-17(2)15-13(6-7-14(19)20-15)18(10-24-11-18)21(16(17)22)12-23-8-9-25(3,4)5/h6-7H,8-12H2,1-5H3 |
| InChIKey | LOXXJYQWUBRDAJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.96 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|