C25H44N2O5Si2 — CID 140806205
8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-6-(2-trimethylsilylethoxymethyl)spiro[1H-1,6-naphthyridine-5,3'-oxetane]-2,7-dione (PubChem CID 140806205) has the molecular formula C25H44N2O5Si2 and a molecular weight of 508.81 g/mol. Its IUPAC name is 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-6-(2-trimethylsilylethoxymethyl)spiro[1H-1,6-naphthyridine-5,3'-oxetane]-2,7-dione.
| Compound Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-6-(2-trimethylsilylethoxymethyl)spiro[1H-1,6-naphthyridine-5,3'-oxetane]-2,7-dione |
|---|---|
| PubChem CID | 140806205 |
| Molecular Formula | C25H44N2O5Si2 |
| Molecular Weight | 508.81 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-8-methyl-6-(2-trimethylsilylethoxymethyl)spiro[1H-1,6-naphthyridine-5,3'-oxetane]-2,7-dione |
| SMILES | CC1(CCO[Si](C)(C)C(C)(C)C)C(=O)N(COCC[Si](C)(C)C)C2(COC2)c2ccc(=O)[nH]c21 |
| InChI | InChI=1S/C25H44N2O5Si2/c1-23(2,3)34(8,9)32-13-12-24(4)21-19(10-11-20(28)26-21)25(16-31-17-25)27(22(24)29)18-30-14-15-33(5,6)7/h10-11H,12-18H2,1-9H3,(H,26,28) |
| InChIKey | ZHSHYSALKHINBU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|