C24H41NO4Si2 — CID 135001531
(1S,8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1-methyl-5-(2-trimethylsilylethoxymethyl)-5-azatricyclo[6.2.2.02,6]dodeca-2(6),3,9-trien-7-one (PubChem CID 135001531) has the molecular formula C24H41NO4Si2 and a molecular weight of 463.77 g/mol. Its IUPAC name is (1S,8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1-methyl-5-(2-trimethylsilylethoxymethyl)-5-azatricyclo[6.2.2.02,6]dodeca-2(6),3,9-trien-7-one.
| Compound Name | (1S,8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1-methyl-5-(2-trimethylsilylethoxymethyl)-5-azatricyclo[6.2.2.02,6]dodeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 135001531 |
| Molecular Formula | C24H41NO4Si2 |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (1S,8S,11R)-11-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-1-methyl-5-(2-trimethylsilylethoxymethyl)-5-azatricyclo[6.2.2.02,6]dodeca-2(6),3,9-trien-7-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@]2(O)C=C[C@@]1(C)c1ccn(COCC[Si](C)(C)C)c1C2=O |
| InChI | InChI=1S/C24H41NO4Si2/c1-22(2,3)31(8,9)29-19-16-24(27)12-11-23(19,4)18-10-13-25(20(18)21(24)26)17-28-14-15-30(5,6)7/h10-13,19,27H,14-17H2,1-9H3/t19-,23+,24-/m1/s1 |
| InChIKey | XCZCPSYDIRSDSI-VEXUSMLFSA-N |
| XLogP | 5.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|