C27H46N2O3Si2 — CID 140502414
1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-4-phenylbutan-1-one (PubChem CID 140502414) has the molecular formula C27H46N2O3Si2 and a molecular weight of 502.85 g/mol. Its IUPAC name is 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-4-phenylbutan-1-one.
| Compound Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 140502414 |
| Molecular Formula | C27H46N2O3Si2 |
| Molecular Weight | 502.85 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 1-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-4-phenylbutan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cn(COCC[Si](C)(C)C)nc1C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C27H46N2O3Si2/c1-27(2,3)34(7,8)32-18-17-24-21-29(22-31-19-20-33(4,5)6)28-26(24)25(30)16-12-15-23-13-10-9-11-14-23/h9-11,13-14,21H,12,15-20,22H2,1-8H3 |
| InChIKey | IQMXBACSKOYTIE-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.85 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|